For research use only. Not for therapeutic Use.
Tridihexethyl Chloride（Cat No.:R022818）is a quaternary ammonium compound used primarily as an anticholinergic agent. It effectively blocks acetylcholine receptors, making it useful in the treatment of peptic ulcers and other gastrointestinal disorders by reducing stomach acid secretion and intestinal spasms. Additionally, it has applications in the management of urinary incontinence and other conditions requiring muscle relaxation. Known for its high purity and reliability, Tridihexethyl Chloride is essential for pharmaceutical research and development, providing consistent results for various therapeutic applications.
| Catalog Number | R022818 |
| CAS Number | 4310-35-4 |
| Synonyms | (3-cyclohexyl-3-hydroxy-3-phenylpropyl)-triethylazanium;chloride |
| Molecular Formula | C21H36ClNO |
| Purity | ≥95% |
| IUPAC Name | (3-cyclohexyl-3-hydroxy-3-phenylpropyl)-triethylazanium;chloride |
| InChI | InChI=1S/C21H36NO.ClH/c1-4-22(5-2,6-3)18-17-21(23,19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7,9-10,13-14,20,23H,4-6,8,11-12,15-18H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XJGONMZLEDGBRM-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CCC(C1CCCCC1)(C2=CC=CC=C2)O.[Cl-] |
