For research use only. Not for therapeutic Use.
Triethyl 2-chloro-2-phosphonoacetate is an organophosphorus compound used in organic synthesis. It serves as a versatile reagent for creating various phosphonate esters and other phosphorus-containing compounds. This chemical is valuable in the development of pharmaceuticals, agrochemicals, and materials science. Its unique reactivity and functional group compatibility make it a critical component in many synthetic pathways.
CAS Number | 7071-12-7 |
Synonyms | 2-Chloro-2- phosphonoacetic acid triethyl ester; Chloro(diethoxyphosphinyl)acetic acid ethyl ester; Ethyl 2-chloro-2-(diethoxyphosphinyl)acetate; Ethyl chloro(diethylphosphono)acetate; Triethyl chlorophosphonoacetate |
Molecular Formula | C8H16ClO5P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 2-chloro-2-diethoxyphosphorylacetate |
InChI | InChI=1S/C8H16ClO5P/c1-4-12-8(10)7(9)15(11,13-5-2)14-6-3/h7H,4-6H2,1-3H3 |
InChIKey | PCDXCIMROXIFBI-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(P(=O)(OCC)OCC)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |