Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds> Triethyl Orthoformate (Formyl-13C)
For research use only. Not for therapeutic Use.
Triethyl Orthoformate (Formyl-13C) is a high-purity isotopically labeled compound essential for advanced pharmaceutical and chemical research. This orthoester, featuring a carbon-13 atom, is crucial for studies involving NMR spectroscopy, isotopic labeling, and organic synthesis. Known for its stability and precise labeling, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
Catalog Number | R021089 |
CAS Number | 118659-62-4 |
Synonyms | 1,1’,1’’-[Methylidyne-13C-tris(oxy)]tris-Ethane; Orthoformic-13C Acid Triethyl Ester; |
Molecular Formula | C7H16O3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | diethoxymethoxyethane |
InChI | InChI=1S/C7H16O3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3/i7+1 |
InChIKey | GKASDNZWUGIAMG-CDYZYAPPSA-N |
SMILES | CCOC(OCC)OCC |