For research use only. Not for therapeutic Use.
Triethyl Phosphonoacetate-13C2(Cat No.:R015108) is an isotopically labeled version of Triethyl Phosphonoacetate, enriched with two carbon-13 atoms. This modification enhances its detection and quantification in nuclear magnetic resonance (NMR) and mass spectrometric analyses, making it crucial for studies involving organic synthesis and reaction mechanisms. The compound serves as a key reagent in the Horner-Wadsworth-Emmons reaction, widely used for forming carbon-carbon double bonds in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. Its isotopic labeling is instrumental in elucidating reaction pathways and optimizing synthetic routes in chemical research.
CAS Number | 100940-60-1 |
Synonyms | Diethyl Ethoxycarbonylmethylphosphonate-13C2; 2-(Diethoxyphosphinyl)acetic Acid-13C2 Ethyl Ester; (Diethoxyphosphinyl)acetic Acid-13C2 Ethyl Ester; Carbethoxymethyldiethyl Phosphonate-13C2; NSC 13898-13C2; NSC 16128-13C2; |
Molecular Formula | C8H17O5P |
Purity | ≥95% |
Storage | Store at +4 ℃ |
IUPAC Name | ethyl 2-diethoxyphosphorylacetate |
InChI | InChI=1S/C8H17O5P/c1-4-11-8(9)7-14(10,12-5-2)13-6-3/h4-7H2,1-3H3/i7+1,8+1 |
InChIKey | GGUBFICZYGKNTD-BFGUONQLSA-N |
SMILES | CCO[13C](=O)[13CH2]P(=O)(OCC)OCC |