For research use only. Not for therapeutic Use.
Triethylammonium phosphate(Cat No.:M122048), is a chemical compound used primarily in organic synthesis and as an ionic liquid. It consists of a triethylammonium cation and a phosphate anion. This compound is valued for its catalytic properties in various chemical reactions, including those involving the formation of carbon-carbon bonds and the synthesis of organic compounds. Additionally, it is employed as an electrolyte in certain electrochemical processes. Triethylammonium phosphate’s ionic nature and reactivity make it a versatile tool in the development of new chemical processes and materials, making it important in both academic and industrial research.
CAS Number | 10138-93-9 |
Molecular Formula | C6H18NO4P |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | N,N-diethylethanamine;phosphoric acid |
InChI | InChI=1S/C6H15N.H3O4P/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) |
InChIKey | UNXNGGMLCSMSLH-UHFFFAOYSA-N |
SMILES | CCN(CC)CC.OP(=O)(O)O |