For research use only. Not for therapeutic Use.
Trifluoromethanesulfonic Anhydride(CAT: R058368) is a powerful reagent used in various chemical transformations. It serves as an acylating agent in organic synthesis, facilitating reactions that involve the transfer of acyl groups. The trifluoromethanesulfonic (triflic) anhydride moiety imparts strong reactivity to the compound, enabling it to promote reactions such as acylation and cyclization. Its ability to introduce acyl groups into molecules makes it valuable for the creation of diverse compounds with desired functionalities.
Catalog Number | R058368 |
CAS Number | 358-23-6 |
Synonyms | Perfluoromethanesulfonic Anhydride; Tirflic Anhydride; Triflate Anhydride; Triflic Acid Anhydride; Triflic Anhydride; Trifluoromethanesulfonic Acid Anhydride; Trifluoromethanesulfonic Anhydride; Trifluoromethylsulfonic Acid Anhydride; Trifluoromethyl |
Molecular Formula | C2F6O5S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate |
InChI | InChI=1S/C2F6O5S2/c3-1(4,5)14(9,10)13-15(11,12)2(6,7)8 |
InChIKey | WJKHJLXJJJATHN-UHFFFAOYSA-N |
SMILES | C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |