For research use only. Not for therapeutic Use.
TriGalNAc CBz（Cat No.:I043374）is a chemical compound used in glycoscience research, specifically in the synthesis of glycopeptides and glycoproteins. It consists of a trisaccharide of N-acetylgalactosamine (GalNAc) linked to a benzyl carbamate (CBz) protective group. This structure is often used as a building block in the synthesis of glycosylated molecules, allowing for controlled attachment of GalNAc to specific targets. TriGalNAc CBz is utilized in studying glycosylation processes, glycoprotein interactions, and developing therapeutic molecules, particularly in the context of gene therapies and treatments for diseases involving glycosylation abnormalities.
| CAS Number | 186613-57-0 |
| Synonyms | 5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dibenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxypentanoic acid |
| Molecular Formula | C34H35NO11 |
| Purity | ≥95% |
| IUPAC Name | 5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dibenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxypentanoic acid |
| InChI | InChI=1S/C34H35NO11/c1-22(36)35-28-30(46-33(41)25-17-9-4-10-18-25)29(45-32(40)24-15-7-3-8-16-24)26(21-43-31(39)23-13-5-2-6-14-23)44-34(28)42-20-12-11-19-27(37)38/h2-10,13-18,26,28-30,34H,11-12,19-21H2,1H3,(H,35,36)(H,37,38)/t26-,28-,29+,30-,34-/m1/s1 |
| InChIKey | OZBZNGCNHUNODU-AWVJDWFHSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OCCCCC(=O)O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
