For research use only. Not for therapeutic Use.
Trigonelline (Cat.No:R015100) is a natural alkaloid found in coffee beans, fenugreek, and other plants. It possesses diverse biological activities, including antioxidant, neuroprotective, and hypoglycemic effects. Trigonelline’s potential in managing diabetes and its impact on human health make it a subject of ongoing research in pharmacology and nutrition.
| CAS Number | 535-83-1 |
| Synonyms | 3-Carboxy-1-methylpyridinium Hydroxide Inner Salt; Betaine Nicotinate; Caffearine; Coffearin; Coffearine; Gynesine; N-Methylnicotinate; N-Methylnicotinic Acid |
| Molecular Formula | C7H7NO2 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | Store at +4℃ |
| IUPAC Name | 1-methylpyridin-1-ium-3-carboxylate |
| InChI | InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
| InChIKey | WWNNZCOKKKDOPX-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=CC(=C1)C(=O)[O-] |
