For research use only. Not for therapeutic Use.
Trihexyl Phosphate (>90%) (Cat No.:C001078) is a chemical compound that consists of a phosphate group and three hexyl groups. It is a clear liquid with high purity, typically containing over 90% trihexyl phosphate. This compound is commonly used as a plasticizer in various polymer applications, such as in the production of flexible PVC, rubber, and cellulose acetate films. Trihexyl Phosphate imparts flexibility and durability to these materials. It is also used as a lubricant and flame retardant in some formulations.
| CAS Number | 2528-39-4 |
| Synonyms | Hexyl Phosphate; Tri(n-hexyl) Phosphate; |
| Molecular Formula | C₁₈H₃₉O₄P |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Colourless to Pale Yellow Oil |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | trihexyl phosphate |
| InChI | InChI=1S/C18H39O4P/c1-4-7-10-13-16-20-23(19,21-17-14-11-8-5-2)22-18-15-12-9-6-3/h4-18H2,1-3H3 |
| InChIKey | SFENPMLASUEABX-UHFFFAOYSA-N |
| SMILES | CCCCCCOP(=O)(OCCCCCC)OCCCCCC |
| Reference | Huang, Hengmei, et al.: Faming Zhuanli Shenqing,В CNВ 102101941В AВ 20110622В (2011) |
