For research use only. Not for therapeutic Use.
Trihexylamine is a high-purity compound used in organic synthesis and industrial applications. This tertiary amine is essential for studying catalytic processes, as a phase transfer catalyst, and in the production of quaternary ammonium compounds. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, trihexylamine enhances research accuracy and efficiency.
| Catalog Number | R023489 |
| CAS Number | 102-86-3 |
| Synonyms | Trihexylamine; N,N-Dihexyl-1-hexanamine; NSC 409786; Tri-n-hexylamine; |
| Molecular Formula | C18H39N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N,N-dihexylhexan-1-amine |
| InChI | InChI=1S/C18H39N/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 |
| InChIKey | DIAIBWNEUYXDNL-UHFFFAOYSA-N |
| SMILES | CCCCCCN(CCCCCC)CCCCCC |
