For research use only. Not for therapeutic Use.
Triiodomesitylene (Cat.No:L003971) is a significant chemical compound known for its unique structure and reactivity. Comprising three iodine atoms attached to a mesitylene framework, it exhibits distinct properties valuable in various chemical reactions. This compound finds applications in organic synthesis, particularly in the creation of specialized molecules for research and industrial purposes.
CAS Number | 19025-36-6 |
Molecular Formula | C9H9I3 |
Purity | ≥95% |
IUPAC Name | 1,3,5-triiodo-2,4,6-trimethylbenzene |
InChI | InChI=1S/C9H9I3/c1-4-7(10)5(2)9(12)6(3)8(4)11/h1-3H3 |
InChIKey | UUMJKZVRNPVQAM-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C(=C1I)C)I)C)I |