For research use only. Not for therapeutic Use.
Triisopropyl phosphite(Cat No.:M069339), is a chemical compound widely used as a reagent and intermediate in various organic synthesis processes. It consists of a phosphorus atom bonded to three isopropyl groups, making it an organophosphorus compound. Triisopropyl phosphite serves as a valuable reagent in the production of various organic phosphorus compounds, including pesticides, flame retardants, and plasticizers. It is also employed in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.
CAS Number | 116-17-6 |
Molecular Formula | C9H21O3P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tripropan-2-yl phosphite |
InChI | InChI=1S/C9H21O3P/c1-7(2)10-13(11-8(3)4)12-9(5)6/h7-9H,1-6H3 |
InChIKey | SJHCUXCOGGKFAI-UHFFFAOYSA-N |
SMILES | CC(C)OP(OC(C)C)OC(C)C |