For research use only. Not for therapeutic Use.
Trilaurin(Cat No.:R027280), is a chemical compound classified as a triglyceride, which means it is composed of three fatty acid chains esterified to a glycerol molecule. Specifically, trilaurin contains three lauric acid chains. Lauric acid is a saturated fatty acid commonly found in coconut oil and palm kernel oil. Trilaurin is used in various industries, including the food and pharmaceutical sectors. It serves as an ingredient in cosmetics, as a source of energy in nutritional supplements, and as a base for the production of soaps and emulsifiers.
CAS Number | 538-24-9 |
Synonyms | Dodecanoic acid 1,2,3-propanetriyl ester; Laurin, tri-; Dynasan 112; Glycerin tridodecanoate; Glycerin trilaurate; Glycerine trilaurate; Glycerol trilaurate; Glyceryl laurate; Glyceryl tridodecanoate; Glyceryl trilaurate; LaLaLa triacylglycerol; Laur |
Molecular Formula | C39H74O6 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 2,3-di(dodecanoyloxy)propyl dodecanoate |
InChI | InChI=1S/C39H74O6/c1-4-7-10-13-16-19-22-25-28-31-37(40)43-34-36(45-39(42)33-30-27-24-21-18-15-12-9-6-3)35-44-38(41)32-29-26-23-20-17-14-11-8-5-2/h36H,4-35H2,1-3H3 |
InChIKey | VMPHSYLJUKZBJJ-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |