For research use only. Not for therapeutic Use.
Trilobatin(Cat No.:R002555)is a sweetener derived from Lithocarpus polystachyus Rehd. It possesses multiple biological activities, including being an HIV-1 inhibitor that targets the Gp41 envelope protein. Trilobatin also exhibits neuroprotective effects, potentially offering benefits in the context of neurodegenerative diseases. Furthermore, it acts as an inhibitor of sodium-glucose cotransporters SGLT1/2 and selectively induces the proliferation of human hepatoblastoma cells. These diverse properties suggest the potential of trilobate in various therapeutic applications, although further research is needed to fully understand its mechanisms and optimize its clinical uses.
CAS Number | 4192-90-9 |
Molecular Formula | C21H24O10 |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
Storage | 4°C, protect from light |
IUPAC Name | 1-[2,6-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)propan-1-one |
InChI | InChI=1S/C21H24O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-12-7-14(25)17(15(26)8-12)13(24)6-3-10-1-4-11(23)5-2-10/h1-2,4-5,7-8,16,18-23,25-29H,3,6,9H2/t16-,18-,19+,20-,21-/m1/s1 |
InChIKey | GSTCPEBQYSOEHV-QNDFHXLGSA-N |
SMILES | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O |