For research use only. Not for therapeutic Use.
TRIM（Cat No.:I010328）, also known as 2,2′,6,6′-Tetramethyl-1-piperidinyloxy or 4-Oxo-2,2,6,6-tetramethylpiperidine 1-oxyl, is a stable free radical compound. It is commonly used as a spin label in electron paramagnetic resonance (EPR) spectroscopy to study the dynamics and conformational changes of biomolecules. TRIM possesses a piperidine-nitroxide moiety, which allows it to interact with various biological systems and provide valuable insights into their structural and functional properties.
| Catalog Number | I010328 |
| CAS Number | 25371-96-4 |
| Synonyms | 1-(2-Trifluoromethylphenyl)imidazole |
| Molecular Formula | C10H7F3N2 |
| Purity | ≥95% |
| Target | NO Synthase |
| Solubility | Soluble to 100 mM in ethanol and to 50 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]imidazole |
| InChI | InChI=1S/C10H7F3N2/c11-10(12,13)8-3-1-2-4-9(8)15-6-5-14-7-15/h1-7H |
| InChIKey | WZBWBNCQUTXYEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N2C=CN=C2 |
