For research use only. Not for therapeutic Use.
Trimellitic Anhydride Chloride is a high-purity compound used in organic synthesis and polymer chemistry. This reactive acid chloride is essential for studying acylation reactions, producing polyimides, and synthesizing various specialty chemicals. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, Trimellitic Anhydride Chloride enhances research accuracy and efficiency.
CAS Number | 1204-28-0 |
Synonyms | 1,3-Dihydro-1,3-dioxo-5-Isobenzofurancarbonyl Chloride;?4-(Chloroformyl)-phthalic Anhydride; 1,3-Benzofurandione-5-carbonyl Chloride; 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carbonyl Chloride; 4-(Chlorocarbonyl)phthalic Anhydride; 4-(Chloroformyl)phtha |
Molecular Formula | C9H3ClO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3-dioxo-2-benzofuran-5-carbonyl chloride |
InChI | InChI=1S/C9H3ClO4/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-3H |
InChIKey | NJMOHBDCGXJLNJ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1C(=O)Cl)C(=O)OC2=O |