For research use only. Not for therapeutic Use.
Trimesic acid is a planar benzoic acid that has been used as a non-immunoglobin protein scaffold for studies of protein-protein interactions. It also has various industrial uses in synthesizing adhesive and coating materials, plastics engineering, and as a pharmaceutical intermediate.
| Catalog Number | R035120 |
| CAS Number | 554-95-0 |
| Synonyms | 1,3,5-Tricarboxybenzene; 5-Carboxyisophthalic Acid; NSC 3998? |
| Molecular Formula | C9H6O6 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid |
| InChI | InChI=1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | QMKYBPDZANOJGF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C(=O)O |
