For research use only. Not for therapeutic Use.
Trimetazidine (Cat No.: I014887) is an antianginal drug that directly relaxes vascular smooth muscle, reduces vascular resistance, and increases coronary and peripheral blood flow. It also promotes myocardial metabolism and energy production, while reducing myocardial oxygen consumption. Trimetazidine enhances tolerance to cardiac glycosides, increases exercise tolerance in patients with angina pectoris, and significantly reduces the frequency of angina attacks, allowing for a reduction in nitroglycerin dosage.
Catalog Number | I014887 |
CAS Number | 5011-34-7 |
Molecular Formula | C₁₄H₂₂N₂O₃ |
Purity | ≥95% |
Target | Autophagy |
Storage | Hygroscopic, Refrigerator, Under inert atmosphere |
IUPAC Name | 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
InChI | InChI=1S/C14H22N2O3/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16/h4-5,15H,6-10H2,1-3H3 |
InChIKey | UHWVSEOVJBQKBE-UHFFFAOYSA-N |
SMILES | COC1=C(C(=C(C=C1)CN2CCNCC2)OC)OC |