For research use only. Not for therapeutic Use.
Trimethyloctylammonium bromide (TOAB) is used as a surfactant and phase transfer catalyst in various chemical reactions. TOAB can be used in the synthesis of nanomaterials due to its ability to selectively transfer ions across interfaces and as a surfactant in the production of emulsions and foams. It is valued for its amphiphilic properties, which allow it to interact with water and oils, stabilizing and dispersing mixtures.
Trimethyloctylammonium bromide is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Catalog Number | I041489 |
CAS Number | 2083-68-3 |
Synonyms | trimethyl(octyl)azanium;bromide |
Molecular Formula | C11H26BrN |
Purity | ≥95% |
InChI | InChI=1S/C11H26N.BrH/c1-5-6-7-8-9-10-11-12(2,3)4;/h5-11H2,1-4H3;1H/q+1;/p-1 |
InChIKey | XCOHAFVJQZPUKF-UHFFFAOYSA-M |
SMILES | CCCCCCCC[N+](C)(C)C.[Br-] |