For research use only. Not for therapeutic Use.
Trimetoquinol hydrochloride is a bronchodilator and cardiac stimulant that acts as a beta-adrenergic agonist. It is used primarily in the treatment of asthma and other respiratory conditions by relaxing bronchial smooth muscles, thereby easing breathing. Additionally, it has cardiotonic properties, which can enhance cardiac output. Trimetoquinol hydrochloride is also studied for its effects on various beta-adrenergic receptors, offering potential therapeutic applications in both respiratory and cardiovascular conditions, where smooth muscle relaxation and increased heart performance are beneficial.
| Catalog Number | I009533 |
| CAS Number | 72534-66-8 |
| Synonyms | RO 07-5965; RO07-5965 RO-07-5965; Trimetoquinol hydrochloride.;(S)-1-(3,4,5-trimethoxybenzyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol hydrochloride hydrate |
| Molecular Formula | C19H26ClNO6 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | (1S)-1-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrate;hydrochloride |
| InChI | InChI=1S/C19H23NO5.ClH.H2O/c1-23-17-7-11(8-18(24-2)19(17)25-3)6-14-13-10-16(22)15(21)9-12(13)4-5-20-14;;/h7-10,14,20-22H,4-6H2,1-3H3;1H;1H2/t14-;;/m0../s1 |
| InChIKey | NYRVBYLXLHGXDP-UTLKBRERSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)CC2C3=CC(=C(C=C3CCN2)O)O.O.Cl |
