For research use only. Not for therapeutic Use.
TriMM（Cat No.:L007484）, is a chemical compound with significant relevance in organic chemistry. This abbreviation likely stands for Tris(trimethylsilyl)methane, a vital reagent in various synthetic processes. TriMM is valued for its ability to act as a strong silylating agent, converting active hydrogen-containing compounds into their corresponding trimethylsilyl derivatives. These derivatives find extensive use in analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy, where they enhance the volatility and stability of the analyzed compounds. Additionally, TriMM serves as a fundamental tool in organic synthesis, aiding in the protection of sensitive functional groups during chemical transformations.
| Catalog Number | L007484 |
| CAS Number | 2827-46-5 |
| Molecular Formula | C6H12N6 |
| Purity | ≥95% |
| IUPAC Name | 2-N,4-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| InChI | InChI=1S/C6H12N6/c1-7-4-10-5(8-2)12-6(9-3)11-4/h1-3H3,(H3,7,8,9,10,11,12) |
| InChIKey | LGEXGKUJMFHVSY-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC(=N1)NC)NC |
