For research use only. Not for therapeutic Use.
Trioctyl phosphate (Cat No.:M121906) is an organophosphorus compound commonly used as a plasticizer, flame retardant, and solvent in various industrial applications. It is a colorless, odorless liquid with high thermal and chemical stability, making it suitable for use in extreme conditions. TOP is primarily used in the production of vinyl resins, cellulose esters, and synthetic rubbers to improve flexibility, durability, and flame resistance. It is also employed in the extraction of rare earth metals and as a solvent for various chemicals.
CAS Number | 1806-54-8 |
Molecular Formula | C24H51O4P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | trioctyl phosphate |
InChI | InChI=1S/C24H51O4P/c1-4-7-10-13-16-19-22-26-29(25,27-23-20-17-14-11-8-5-2)28-24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
InChIKey | WVPGXJOLGGFBCR-UHFFFAOYSA-N |
SMILES | CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC |