For research use only. Not for therapeutic Use.
Tripentyltin chloride is an organotin compound. It is composed of three pentyl groups attached to a central tin atom, each esterified with chloride. This compound is utilized primarily as a precursor in organic synthesis, particularly in the production of other organotin compounds and as a catalyst in various chemical reactions. Its technical-grade formulation indicates it may contain impurities and is typically used in industrial processes rather than in pharmaceutical or fine chemical applications.
| Catalog Number | R069751 |
| CAS Number | 3342-67-4 |
| Molecular Formula | C15H33ClSn |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | chloro(tripentyl)stannane |
| InChI | InChI=1S/3C5H11.ClH.Sn/c3*1-3-5-4-2;;/h3*1,3-5H2,2H3;1H;/q;;;;+1/p-1 |
| InChIKey | LKGICXFRDGZQHA-UHFFFAOYSA-M |
| SMILES | CCCCC[Sn](CCCCC)(CCCCC)Cl |
