For research use only. Not for therapeutic Use.
Triphenyl Phosphorothioate (Cat No.:C001081) is a chemical compound containing a phosphorus atom and a sulfur atom, with three phenyl groups attached. It is an organophosphorus compound that exhibits insecticidal and acaricidal properties, making it a valuable ingredient in certain pesticides and insect repellents. Triphenyl Phosphorothioate acts as an acetylcholinesterase inhibitor, disrupting neurotransmission in insects and pests, leading to their paralysis and death.
| CAS Number | 597-82-0 |
| Synonyms | Triphenyl Phosphorothionate; Triphenyl Thiophosphate; Phenyl Phosphorothioate; NSC 57867; O,O,O-Triphenyl Phosphorothioate; O,O,O-Triphenyl Thiophosphate; T 309; Thiophosphoric Acid Triphenyl Ester; Triphenoxyphosphine Sulfide; Phosphorothioic Acid O,O,O-Triphenyl Ester |
| Molecular Formula | C₁₈H₁₅O₃PS |
| Purity | ≥95% |
| Solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| Appearance | No data available |
| Storage | -20°C |
| IUPAC Name | triphenoxy(sulfanylidene)-λ5-phosphane |
| InChI | InChI=1S/C18H15O3PS/c23-22(19-16-10-4-1-5-11-16,20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18/h1-15H |
| InChIKey | IKXFIBBKEARMLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OP(=S)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| Reference | Xiong, X., et al.: Faming Zhuanli Shenqing, CNВ 105238526 A, 20160113 (2016) |
