For research use only. Not for therapeutic Use.
(Triphenylphosphoranylidene)acetaldehyde (Cat.No:R000477) is an organophosphorus compound utilized in Wittig reactions for synthesizing alkenes. Acting as a reagent, it reacts with carbonyl compounds to form carbon-carbon double bonds. This reaction is crucial in organic synthesis, allowing the creation of diverse molecules with specific structural features.
| Catalog Number | R000477 |
| CAS Number | 2136-75-6 |
| Synonyms | 2-(Triphenylphosphoranylidene)-acetaldehyde; (Formylmethylene)triphenylphosphorane; (2-Oxoethylidene)triphenylphosphorane |
| Molecular Formula | C20H17OP |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(triphenyl-$l^{5} |
| InChI | InChI=1S/C20H17OP/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H |
| InChIKey | CQCAYWAIRTVXIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=CC=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
