For research use only. Not for therapeutic Use.
Triphenylsilanol(Cat No.:I014746)is an organosilicon compound with the chemical formula (C₆H₅)₃SiOH. It consists of a silicon atom bonded to three phenyl groups and a hydroxyl group. It is commonly used as a reagent in organic synthesis, particularly in the preparation of silane derivatives and as a precursor for various silicon-based compounds. Triphenylsilanol also plays a role in surface modification and in the synthesis of materials for electronic applications. Its unique structure and reactivity make it valuable in developing new chemical processes and materials, although its biological activity is less explored.
CAS Number | 791-31-1 |
Synonyms | Triphenylsilanol;Silane, hydroxytriphenyl- |
Molecular Formula | C18H16OSi |
Purity | ≥95% |
Solubility | Soluble in DMSO |
IUPAC Name | hydroxy(triphenyl)silane |
InChI | InChI=1S/C18H16OSi/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H |
InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)O |