For research use only. Not for therapeutic Use.
Tripotassium hydrogen ethylenediaminetetraacetate(Cat No.:M076059), is a chemical compound that serves as a chelating agent and sequestering agent. It belongs to a class of compounds known as chelating agents, which are used to bind and remove metal ions from solutions. This compound is particularly effective at binding and controlling the presence of various metal ions, including calcium, magnesium, and iron. It is used in a wide range of industrial applications, such as water treatment, food processing, and cleaning products, to prevent the deleterious effects of metal ions, such as scale formation and oxidation.
CAS Number | 17572-97-3 |
Molecular Formula | C10H13K3N2O8 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
InChI | InChI=1S/C10H16N2O8.3K/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;/q;3*+1/p-3 |
InChIKey | FYZXEMANQYHCFX-UHFFFAOYSA-K |
SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[K+].[K+].[K+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |