For research use only. Not for therapeutic Use.
Tripropyl orthoformate（Cat No.:L006918）, is an organic compound. It is a clear, colorless liquid that serves as a versatile reagent in organic synthesis. This compound is used as a protecting group for alcohols, facilitating various transformations in organic chemistry. Tripropyl orthoformate is also employed as a reagent in the preparation of esters and other derivatives. Its reactivity and stability under different reaction conditions make it valuable in the synthesis of pharmaceuticals, agrochemicals, and fragrances.
| Catalog Number | L006918 |
| CAS Number | 621-76-1 |
| Molecular Formula | C10H22O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(dipropoxymethoxy)propane |
| InChI | InChI=1S/C10H22O3/c1-4-7-11-10(12-8-5-2)13-9-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | RWNXXQFJBALKAX-UHFFFAOYSA-N |
| SMILES | CCCOC(OCCC)OCCC |
