For research use only. Not for therapeutic Use.
Tripropyl phosphate-d21 (Cat No.:R030310) is a deuterated derivative of tripropyl phosphate, used in scientific research, particularly in studies involving isotopic labeling. The “d21” in its name refers to the replacement of hydrogen atoms with deuterium, a stable isotope of hydrogen. This modification helps track molecular interactions or reactions in experiments, such as NMR spectroscopy, where deuterium’s distinct properties improve the clarity and resolution of results. It is utilized in various fields, including chemistry, pharmacology, and environmental science.
CAS Number | 1219794-92-9 |
Synonyms | tris(1,1,2,2,3,3,3-heptadeuteriopropyl) phosphate |
Molecular Formula | C9D21O4P |
Purity | ≥95% |
IUPAC Name | tris(1,1,2,2,3,3,3-heptadeuteriopropyl) phosphate |
InChI | InChI=1S/C9H21O4P/c1-4-7-11-14(10,12-8-5-2)13-9-6-3/h4-9H2,1-3H3/i1D3,2D3,3D3,4D2,5D2,6D2,7D2,8D2,9D2 |
InChIKey | RXPQRKFMDQNODS-JPWMFWTESA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])OP(=O)(OC([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |