For research use only. Not for therapeutic Use.
Triptohypol C(Cat No.:I026146)is a bioactive compound derived from natural sources, known for its potential antioxidant and anti-inflammatory properties. It is a derivative of tryptophan, an essential amino acid, and has been studied for its role in modulating various cellular pathways. Triptohypol C has shown promise in preclinical research for its ability to reduce oxidative stress and inflammation, making it a potential therapeutic candidate for diseases linked to these processes, such as neurodegenerative disorders and cardiovascular diseases. Researchers are exploring its further potential in drug development and natural product-based therapies.
CAS Number | 193957-88-9 |
Synonyms | (2R,4aS,6aS,6aS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
Molecular Formula | C29H40O4 |
Purity | ≥95% |
IUPAC Name | (2R,4aS,6aS,6aS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
InChI | InChI=1S/C29H40O4/c1-17-18-7-8-21-27(4,19(18)15-20(30)23(17)31)12-14-29(6)22-16-26(3,24(32)33)10-9-25(22,2)11-13-28(21,29)5/h8,15,22,30-31H,7,9-14,16H2,1-6H3,(H,32,33)/t22-,25-,26-,27+,28-,29+/m1/s1 |
InChIKey | WZAUFGYINZYCKH-JJWQIEBTSA-N |
SMILES | CC1=C2CC=C3[C@](C2=CC(=C1O)O)(CC[C@@]4([C@@]3(CC[C@@]5([C@H]4C[C@](CC5)(C)C(=O)O)C)C)C)C |