For research use only. Not for therapeutic Use.
Triptolide(CAT: I003420) is a diterpenoid epoxide derived from the Chinese medicinal plant Tripterygium wilfordii, known for its potent anti-inflammatory, immunosuppressive, and anticancer properties. It acts by inhibiting RNA polymerase II-mediated transcription, leading to the downregulation of pro-inflammatory cytokines and tumor-promoting factors. Triptolide also induces apoptosis and inhibits cell proliferation, making it a valuable tool in cancer, autoimmune disease, and inflammation research. Its multifaceted mechanisms of action have spurred interest in exploring its therapeutic potential and developing derivatives with improved efficacy and reduced toxicity.
CAS Number | 38748-32-2 |
Synonyms | (6aS,7aS,8R,8aR,9aS,9bS,10aS,10bS)-8-hydroxy-8a-isopropyl-10b-methyl-1,5,5b,6,6a,8,8a,9a,9b,10b-decahydrotris(oxireno)[2/’,3/’:4b,5;2/’/’,3/’/’:6,7;2/’/’/’,3/’/’/’:8a,9]phenanthro[1,2-c]furan-3(2H)-one |
Molecular Formula | C₂₀H₂₄O₆ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 33 mg/mL |
Storage | 3 years -20C powder |
IUPAC Name | (1S,2S,4S,5S,7R,8R,9S,11S,13S)-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
InChI | InChI=1S/C20H24O6/c1-8(2)18-13(25-18)14-20(26-14)17(3)5-4-9-10(7-23-15(9)21)11(17)6-12-19(20,24-12)16(18)22/h8,11-14,16,22H,4-7H2,1-3H3/t11-,12-,13-,14-,16+,17-,18-,19+,20+/m0/s1 |
InChIKey | DFBIRQPKNDILPW-CIVMWXNOSA-N |
SMILES | CC(C)[C@@]12[C@@H](O1)[C@H]3[C@@]4(O3)[C@]5(CCC6=C([C@@H]5C[C@H]7[C@]4([C@@H]2O)O7)COC6=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |