For research use only. Not for therapeutic Use.
Triptonide is a diterpenoid compound derived from Tripterygium wilfordii with notable anti-inflammatory, anticancer, and immunomodulatory properties. It inhibits NF-κB and STAT3 signaling pathways, making it a valuable agent for research in inflammation and cancer. Triptonide has shown promise in inducing apoptosis in tumor cells and suppressing tumor growth. Additionally, it is explored for its potential in autoimmune and reproductive health studies, including reversible male contraception. Its broad bioactivity positions it as a critical compound for pharmacological and biomedical research.
Catalog Number | I003418 |
CAS Number | 38647-11-9 |
Synonyms | (5bS,6aS,7aS,8aS,9aS,9bS,10aS,10bS)-8a-isopropyl-10b-methyl-1,5b,6,6a,8a,9a,9b,10b-octahydrotris(oxireno)[2′,3′:4b,5;2”,3”:6,7;2”’,3”’:8a,9]phenanthro[1,2-c]furan-3,8(2H,5H)-dione |
Molecular Formula | C20H22O6 |
Purity | ≥95% |
Target | dCTP Pyrophosphatase |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | (1S,2S,4S,5S,7S,9S,11S,13S)-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-ene-8,17-dione |
InChI | InChI=1S/C20H22O6/c1-8(2)18-13(25-18)14-20(26-14)17(3)5-4-9-10(7-23-15(9)21)11(17)6-12-19(20,24-12)16(18)22/h8,11-14H,4-7H2,1-3H3/t11-,12-,13-,14-,17-,18-,19+,20+/m0/s1 |
InChIKey | SWOVVKGLGOOUKI-ZHGGVEMFSA-N |
SMILES | CC(C)[C@@]12[C@@H](O1)[C@H]3[C@@]4(O3)[C@]5(CCC6=C([C@@H]5C[C@H]7[C@]4(C2=O)O7)COC6=O)C |