For research use only. Not for therapeutic Use.
Triptycene（Cat No.:R069753）, is a polycyclic aromatic hydrocarbon (PAH) characterized by its unique and symmetrical three-ring structure. This compound is of significant interest in organic chemistry due to its rigid, non-planar structure, which makes it valuable in the development of various organic molecules and materials. Triptycene derivatives find applications in the construction of molecular machines, host-guest chemistry, and as molecular scaffolds for functional materials.
| Catalog Number | R069753 |
| CAS Number | 477-75-8 |
| Synonyms | 9.10-Dihydro-9.10-o-benzenoanthracene |
| Molecular Formula | C20H14 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
| InChI | InChI=1S/C20H14/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)20(14)18-12-6-4-10-16(18)19/h1-12,19-20H |
| InChIKey | NGDCLPXRKSWRPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3C4=CC=CC=C4C(C2=C1)C5=CC=CC=C35 |
