For research use only. Not for therapeutic Use.
Tris(1-chloro-2-propyl) Phosphate(CAT: R040552) is a flame retardant chemical with diverse applications primarily in material chemistry. This compound acts as an effective flame-retardant additive in various materials, including plastics, textiles, and foam products. Its mechanism of action involves forming a protective barrier, reducing the flammability of these materials, and delaying the spread of fire. In material chemistry, it plays a crucial role in enhancing the fire safety of consumer products, making it a valuable component in the development of fire-resistant materials.
| Catalog Number | R040552 |
| CAS Number | 13674-84-5 |
| Synonyms | Tris(2-chloroisopropyl) Phosphate; Antiblaze 80; Antiblaze TMCP; Daltoguard F; Fyrol PCF; Hostaflam OP 820; Levagard PP; Levagard PP-Z; PUMA 4010; TCPP; Tolgard TMCP; Tris(1-methyl-2-chloroethyl) Phosphate; Tris(2-chloro-1-methylethyl) Phosphate;Tris |
| Molecular Formula | C9H18Cl3O4P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | tris(1-chloropropan-2-yl) phosphate |
| InChI | InChI=1S/C9H18Cl3O4P/c1-7(4-10)14-17(13,15-8(2)5-11)16-9(3)6-12/h7-9H,4-6H2,1-3H3 |
| InChIKey | KVMPUXDNESXNOH-UHFFFAOYSA-N |
| SMILES | CC(CCl)OP(=O)(OC(C)CCl)OC(C)CCl |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Netten, C. van, et al. "TRI (2-CHLOROISOPROPYL) PHOSPHATE—AN UNEXPECTED ORGANOCHLORINE CONTAMINANT IN SOME CHARCOAL AIR-SAMPLING SORBENT TUBES." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>American Industrial Hygiene Association Journal</i> 52.9 (1991): 398-401.<br /> |
