For research use only. Not for therapeutic Use.
Tris(3-chloro-1-propyl)phosphate(Cat No.:M071678), is a chemical compound used as a flame retardant and plasticizer in various industries. It belongs to a group of organophosphates and is known for its ability to reduce the flammability of materials like plastics, textiles, and foam products. This compound is often incorporated into products to enhance fire resistance, making it valuable for applications where fire safety is a concern.
Catalog Number | M071678 |
CAS Number | 1067-98-7 |
Molecular Formula | C9H18Cl3O4P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tris(3-chloropropyl) phosphate |
InChI | InChI=1S/C9H18Cl3O4P/c10-4-1-7-14-17(13,15-8-2-5-11)16-9-3-6-12/h1-9H2 |
InChIKey | WOURXYYHORRGQO-UHFFFAOYSA-N |
SMILES | C(COP(=O)(OCCCCl)OCCCCl)CCl |