For research use only. Not for therapeutic Use.
Tris(4-pyridyl)-s-triazine(Cat No.:R016120), is a chemical compound commonly used in coordination chemistry as a ligand to form complexes with various metal ions. This compound has a tridentate binding capability, thanks to its three pyridyl groups, which can coordinate with metal ions, leading to the formation of stable and sometimes colorful coordination complexes. These complexes find applications in catalysis, materials science, and analytical chemistry.
CAS Number | 42333-78-8 |
Synonyms | 2,4,6-Tri-4-pyridinyl-1,3,5-triazine; 1,3,5-Tris(4-pyridyl)-2,4,6-triazine; 2,4,6-Tri(4-pyridyl)-1,3,5-triazine; 2,4,6-Tri(4-pyridyl)-s-triazine; 2,4,6-Tri(pyridin-4-yl)-1,3,5-triazine; 2,4,6-Tri-4-pyridyltriazine; 2,4,6-Tris(4-pyridinyl)-1,3,5-triaz |
Molecular Formula | C18H12N6 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2,4,6-tripyridin-4-yl-1,3,5-triazine |
InChI | InChI=1S/C18H12N6/c1-7-19-8-2-13(1)16-22-17(14-3-9-20-10-4-14)24-18(23-16)15-5-11-21-12-6-15/h1-12H |
InChIKey | CBMYFVSIIYILRH-UHFFFAOYSA-N |
SMILES | C1=CN=CC=C1C2=NC(=NC(=N2)C3=CC=NC=C3)C4=CC=NC=C4 |