For research use only. Not for therapeutic Use.
Tris(4-(vinyloxy)butyl)trimellitate(Cat No.:M139210) is a chemical compound used in the production of polymers and coatings. This compound is a trimellitate ester, meaning it has three carboxylic acid groups attached to a central trimellitic acid core. The butyl chains with vinyloxy groups make this compound suitable for use as a crosslinking agent in polymerization reactions, where it helps to form strong, flexible bonds between polymer chains. Tris(4-(vinyloxy)butyl)trimellitate is commonly used in the manufacturing of adhesives, coatings, and other polymer-based products where high strength and flexibility are desired.
Catalog Number | M139210 |
CAS Number | 196109-17-8 |
Molecular Formula | C27H36O9 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tris(4-ethenoxybutyl) benzene-1,2,4-tricarboxylate |
InChI | InChI=1S/C27H36O9/c1-4-31-15-7-10-18-34-25(28)22-13-14-23(26(29)35-19-11-8-16-32-5-2)24(21-22)27(30)36-20-12-9-17-33-6-3/h4-6,13-14,21H,1-3,7-12,15-20H2 |
InChIKey | XOTMHFNWERTCLG-UHFFFAOYSA-N |
SMILES | C=COCCCCOC(=O)C1=CC(=C(C=C1)C(=O)OCCCCOC=C)C(=O)OCCCCOC=C |