For research use only. Not for therapeutic Use.
Tris(trimethylsilyl)phosphine(Cat No.: M084739) is an organophosphorus compound with the chemical formula P(SiMe3)3. It is a colorless, pyrophoric liquid that is soluble in non-polar solvents. Tris(trimethylsilyl)phosphine is often used as a reducing agent in organic synthesis to convert various functional groups, such as carbonyls and nitro groups, to their corresponding reduced forms. It is also commonly used in the synthesis of phosphorus-containing compounds and as a catalyst for polymerization reactions.
CAS Number | 15573-38-3 |
Molecular Formula | C9H27PSi3 |
Purity | ≥95% |
Storage | 0-6°C |
IUPAC Name | tris(trimethylsilyl)phosphane |
InChI | InChI=1S/C9H27PSi3/c1-11(2,3)10(12(4,5)6)13(7,8)9/h1-9H3 |
InChIKey | OUMZKMRZMVDEOF-UHFFFAOYSA-N |
SMILES | C[Si](C)(C)P([Si](C)(C)C)[Si](C)(C)C |