For research use only. Not for therapeutic Use.
Tris(1-pyrrolidinyl)phosphine (CAT: L000261) is a valuable compound primarily used in organic and coordination chemistry. It serves as a critical ligand in coordination chemistry, often forming complexes with transition metals. These complexes are essential in various catalytic reactions, including those in organic synthesis.
CAS Number | 5666-12-6 |
Molecular Formula | C12H24N3P |
Purity | ≥95% |
IUPAC Name | tripyrrolidin-1-ylphosphane |
InChI | InChI=1S/C12H24N3P/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15/h1-12H2 |
InChIKey | PXFLCAQHOZXYED-UHFFFAOYSA-N |