For research use only. Not for therapeutic Use.
Tris(1H-benzotriazole-1-ylmethyl)amine(CAT: L000354) is a chemical compound with essential applications in material chemistry and corrosion inhibition. This compound acts as a powerful corrosion inhibitor, protecting metals from degradation by forming a protective layer on their surfaces. It finds extensive use in various industries, including the production of coatings, lubricants, and water treatment formulations. Its benzotriazole-based structure imparts excellent anti-corrosion properties, making it an invaluable tool for preserving the integrity of metal components.
CAS Number | 121238-82-2 |
Molecular Formula | C21H18N10 |
Purity | ≥95% |
IUPAC Name | 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine |
InChI | InChI=1S/C21H18N10/c1-4-10-19-16(7-1)22-25-29(19)13-28(14-30-20-11-5-2-8-17(20)23-26-30)15-31-21-12-6-3-9-18(21)24-27-31/h1-12H,13-15H2 |
InChIKey | CGTJPXSHORTCPU-UHFFFAOYSA-N |