For research use only. Not for therapeutic Use.
Trithiozine(Cat No.:I037544)is a synthetic compound that functions as a potent inhibitor of the proteasome, a key complex involved in degrading unneeded or damaged proteins within cells. By inhibiting proteasome activity, Trithiozine disrupts cellular protein homeostasis, leading to the accumulation of damaged proteins and impaired cellular function. This mechanism has therapeutic potential in treating various diseases, including cancers, where abnormal protein degradation plays a role in tumorigenesis. Trithiozine is being studied for its potential to enhance the effectiveness of cancer treatments by targeting the proteasome and altering tumor cell survival pathways.
CAS Number | 35619-65-9 |
Synonyms | morpholin-4-yl-(3,4,5-trimethoxyphenyl)methanethione |
Molecular Formula | C14H19NO4S |
Purity | ≥95% |
IUPAC Name | morpholin-4-yl-(3,4,5-trimethoxyphenyl)methanethione |
InChI | InChI=1S/C14H19NO4S/c1-16-11-8-10(9-12(17-2)13(11)18-3)14(20)15-4-6-19-7-5-15/h8-9H,4-7H2,1-3H3 |
InChIKey | MVOUIYUWRXPNKD-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1OC)OC)C(=S)N2CCOCC2 |