For research use only. Not for therapeutic Use.
Troglitazone sulfate sodium(Cat No.:M132892) is a derivative of troglitazone, an antidiabetic medication that belongs to the thiazolidinedione class. It acts as an agonist for peroxisome proliferator-activated receptor gamma (PPAR-γ), which plays a key role in glucose and lipid metabolism. Troglitazone sulfate sodium is used to treat type 2 diabetes mellitus by improving insulin sensitivity in tissues such as adipose, skeletal muscle, and liver. By activating PPAR-γ, it enhances the transcription of genes involved in glucose uptake and utilization, as well as lipid metabolism, ultimately leading to improved glycemic control.
Catalog Number | M132892 |
CAS Number | 110765-08-7 |
Synonyms | Troglitazone Sulfate SodiuM |
Molecular Formula | C24H26NNaO8S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | sodium;[2-[[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] sulfate |
InChI | InChI=1S/C24H27NO8S2.Na/c1-13-14(2)21-18(15(3)20(13)33-35(28,29)30)9-10-24(4,32-21)12-31-17-7-5-16(6-8-17)11-19-22(26)25-23(27)34-19;/h5-8,19H,9-12H2,1-4H3,(H,25,26,27)(H,28,29,30);/q;+1/p-1 |
InChIKey | QDIKTIPHNIELCY-UHFFFAOYSA-M |
SMILES | CC1=C(C(=C(C2=C1OC(CC2)(C)COC3=CC=C(C=C3)CC4C(=O)NC(=O)S4)C)OS(=O)(=O)[O-])C.[Na+] |