For research use only. Not for therapeutic Use.
Tropolone（Cat No.:R006193）is a seven-membered aromatic compound notable for its unique structure and reactive properties, widely used in biochemical research. As a non-benzenoid aromatic, it features a hydroxyl group and a distinctive conjugated ring system that grants it potent metal-chelating abilities. This property makes Tropolone valuable in enzymatic studies, particularly in the inhibition of metalloenzymes. Additionally, its antimicrobial and antioxidant activities are explored in pharmaceutical and agricultural contexts. With high versatility, Tropolone serves as a key component in the synthesis of complex organic molecules, facilitating advancements in medicinal chemistry.
| Catalog Number | R006193 |
| CAS Number | 533-75-5 |
| Molecular Formula | C7H6O2 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 2-hydroxycyclohepta-2,4,6-trien-1-one |
| InChI | InChI=1S/C7H6O2/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H,8,9) |
| InChIKey | MDYOLVRUBBJPFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=O)C=C1)O |
