For research use only. Not for therapeutic Use.
Tropylium tetrafluoroborate(Cat No.:L006915), is a chemical compound consisting of a tropylium cation (C7H7⁺) and tetrafluoroborate anions (BF₄⁻). It is a stable, crystalline salt, often used as a convenient source of the tropylium cation in various chemical reactions. The tropylium ion is a resonance-stabilized carbocation with a planar, aromatic structure, making it highly reactive in organic synthesis. Tropylium tetrafluoroborate is widely employed as a catalyst and reagent in Friedel-Crafts reactions, electrophilic aromatic substitutions, and other organic transformations. Its versatility makes it valuable in the creation of complex organic molecules and the development of pharmaceuticals and advanced materials.
CAS Number | 27081-10-3 |
Molecular Formula | C7H7BF4 |
Purity | ≥95% |
IUPAC Name | cyclohepta-1,3,5-triene;tetrafluoroborate |
InChI | InChI=1S/C7H7.BF4/c1-2-4-6-7-5-3-1;2-1(3,4)5/h1-7H;/q+1;-1 |
InChIKey | SQVQHTIKOZVGLR-UHFFFAOYSA-N |
SMILES | [B-](F)(F)(F)F.C1=CC=C[CH+]C=C1 |