For research use only. Not for therapeutic Use.
Troviridine(Cat No.:I001842) is a non-nucleoside HIV-1 reverse transcriptase inhibitor. It belongs to a class of compounds that specifically target the reverse transcriptase enzyme of the human immunodeficiency virus (HIV-1). These inhibitors work by binding to the reverse transcriptase enzyme and blocking its activity, thus preventing the conversion of viral RNA into DNA, which is necessary for the replication of the virus. By inhibiting this crucial step in the viral life cycle, troviridine and similar compounds can help suppress the replication of HIV-1 and potentially slow down the progression of HIV/AIDS.
CAS Number | 149488-17-5 |
Molecular Formula | C₁₃H₁₃BrN₄S |
Purity | ≥95% |
Target | HIV |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IC50 | 7 nM |
IUPAC Name | 1-(5-bromopyridin-2-yl)-3-(2-pyridin-2-ylethyl)thiourea |
InChI | InChI=1S/C13H13BrN4S/c14-10-4-5-12(17-9-10)18-13(19)16-8-6-11-3-1-2-7-15-11/h1-5,7,9H,6,8H2,(H2,16,17,18,19) |
InChIKey | HOCFDYZWQYGULA-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)CCNC(=S)NC2=NC=C(C=C2)Br |
Reference | 1: Gavriliu D, Fossey C, Ciurea A, Delbederi Z, Sugeac E, Ladurée D, Schmidt S, |