For research use only. Not for therapeutic Use.
TRPC6-IN-3(Cat No.:I042883)is a selective inhibitor targeting the Transient Receptor Potential Cation Channel Subfamily C Member 6 (TRPC6), a protein involved in calcium ion influx and cell signaling. TRPC6 plays a role in various physiological processes, including cardiovascular function, neuronal activity, and kidney filtration. By inhibiting TRPC6, TRPC6-IN-3 helps modulate abnormal calcium signaling, which is implicated in diseases such as hypertension, heart failure, and kidney disorders. This compound is being investigated for its potential therapeutic applications in conditions where TRPC6 overactivation contributes to disease pathogenesis.
CAS Number | 2311863-36-0 |
Synonyms | [4-(6-aminopyridazin-3-yl)piperidin-1-yl]-[5-(4-fluorophenoxy)-4-methoxypyridin-2-yl]methanone |
Molecular Formula | C22H22FN5O3 |
Purity | ≥95% |
IUPAC Name | [4-(6-aminopyridazin-3-yl)piperidin-1-yl]-[5-(4-fluorophenoxy)-4-methoxypyridin-2-yl]methanone |
InChI | InChI=1S/C22H22FN5O3/c1-30-19-12-18(25-13-20(19)31-16-4-2-15(23)3-5-16)22(29)28-10-8-14(9-11-28)17-6-7-21(24)27-26-17/h2-7,12-14H,8-11H2,1H3,(H2,24,27) |
InChIKey | JUALOUHZJJERQT-UHFFFAOYSA-N |
SMILES | COC1=CC(=NC=C1OC2=CC=C(C=C2)F)C(=O)N3CCC(CC3)C4=NN=C(C=C4)N |