For research use only. Not for therapeutic Use.
TRV-7019(Cat No.:I041160)is a selective small molecule inhibitor that targets the histone deacetylase 6 (HDAC6), an enzyme involved in regulating cellular processes such as protein degradation, cell migration, and stress response. By inhibiting HDAC6, TRV-7019 modulates the acetylation of tubulin and other substrates, leading to changes in cellular dynamics and immune responses. This compound is being investigated for its potential therapeutic applications in cancer, neurodegenerative diseases, and autoimmune disorders. TRV-7019’s ability to affect protein homeostasis and cellular function makes it a promising candidate for drug development in these areas.
CAS Number | 2598164-15-7 |
Synonyms | (4-iodophenyl)methyl 6-methoxypyridine-2-carboxylate |
Molecular Formula | C14H12INO3 |
Purity | ≥95% |
IUPAC Name | (4-iodophenyl)methyl 6-methoxypyridine-2-carboxylate |
InChI | InChI=1S/C14H12INO3/c1-18-13-4-2-3-12(16-13)14(17)19-9-10-5-7-11(15)8-6-10/h2-8H,9H2,1H3 |
InChIKey | AVKHPDWARYICID-UHFFFAOYSA-N |
SMILES | COC1=CC=CC(=N1)C(=O)OCC2=CC=C(C=C2)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |