For research use only. Not for therapeutic Use.
TRV130 is an investigational drug designed to provide pain relief with fewer side effects compared to traditional opioids. It belongs to a class of medications called G protein-biased mu-opioid receptor agonists, which target the mu-opioid receptor in a way that activates certain pathways more than others. This targeted activation is believed to reduce the risk of respiratory depression and constipation, common side effects of opioids. TRV130 is being studied for its potential to treat acute severe pain, such as postoperative pain.
CAS Number | 1401028-24-7 |
Synonyms | Oliceridine |
Molecular Formula | C22H30N2O2S |
Purity | ≥95% |
Target Protein | |
Appearance | Solid |
IUPAC Name | N-[(3-methoxythiophen-2-yl)methyl]-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine |
InChI | InChI=1S/C22H30N2O2S/c1-25-18-7-15-27-19(18)16-23-13-10-21(20-6-2-5-12-24-20)11-14-26-22(17-21)8-3-4-9-22/h2,5-7,12,15,23H,3-4,8-11,13-14,16-17H2,1H3/t21-/m1/s1 |
InChIKey | DMNOVGJWPASQDL-OAQYLSRUSA-N |
SMILES | COC1=C(SC=C1)CNCCC2(CCOC3(C2)CCCC3)C4=CC=CC=N4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |