For research use only. Not for therapeutic Use.
Tryptanthrin(Cat No.:R029052) is a natural alkaloid and indole derivative found in various plants, including Polygonum tinctorium. Its action target involves various biological activities due to its complex chemical structure. The mode of action includes potential anti-inflammatory, antioxidant, and antimicrobial effects. Pharmacologically, tryptanthrin has shown promise in various medicinal applications, including its potential as an anti-inflammatory agent to reduce inflammation, its role as an antioxidant to combat oxidative stress, and its ability to exhibit antimicrobial activity against certain microorganisms. Additionally, it has been investigated for its potential in managing various inflammatory and immune-related disorders.
CAS Number | 13220-57-0 |
Synonyms | Indolo[2,1-b]quinazoline-6,12-dione; Couroupitine A; NSC 349447; Tryptanthrin?Tryptanthrine; |
Molecular Formula | C15H8N2O2 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | indolo[2,1-b]quinazoline-6,12-dione |
InChI | InChI=1S/C15H8N2O2/c18-13-10-6-2-4-8-12(10)17-14(13)16-11-7-3-1-5-9(11)15(17)19/h1-8H |
InChIKey | VQQVWGVXDIPORV-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)N3C4=CC=CC=C4C(=O)C3=N2 |