For research use only. Not for therapeutic Use.
TSPO ligand-1（Cat No.:I043342）is a selective small-molecule ligand that binds to the translocator protein (TSPO), which is primarily located in the outer mitochondrial membrane. TSPO plays a crucial role in cellular processes such as mitochondrial function, apoptosis, and inflammation. By modulating TSPO activity, TSPO ligand-1 holds potential for therapeutic applications in various neuroinflammatory and neurodegenerative conditions, including Alzheimer’s disease and Parkinson’s disease. Additionally, its interaction with TSPO may offer neuroprotective effects. Research is ongoing to explore the compound’s effectiveness in targeting the TSPO pathway for treating central nervous system disorders and other related diseases.
| CAS Number | 4560-08-1 |
| Synonyms | 2-oxo-2-(2-phenyl-1H-indol-3-yl)acetyl chloride |
| Molecular Formula | C16H10ClNO2 |
| Purity | ≥95% |
| IUPAC Name | 2-oxo-2-(2-phenyl-1H-indol-3-yl)acetyl chloride |
| InChI | InChI=1S/C16H10ClNO2/c17-16(20)15(19)13-11-8-4-5-9-12(11)18-14(13)10-6-2-1-3-7-10/h1-9,18H |
| InChIKey | DREHVYWKTXGDBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C(=O)C(=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
